About N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine
N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine (PubChem CID 46203484) has the molecular formula C22H42N2
and a molecular weight of 334.59 g/mol. Its IUPAC name is N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine |
| PubChem CID | 46203484 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine |
| SMILES | CC(C)CCCC(C)CCNCCNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H42N2/c1-17(2)5-4-6-18(3)7-8-23-9-10-24-22-14-19-11-20(15-22)13-21(12-19)16-22/h17-21,23-24H,4-16H2,1-3H3 |
| InChIKey | RCCJBGBGOFXTKU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine?
The IUPAC name of N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine (CID 46203484) is N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine?
The canonical SMILES for N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine is CC(C)CCCC(C)CCNCCNC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine?
The InChIKey is RCCJBGBGOFXTKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N2/c1-17(2)5-4-6-18(3)7-8-23-9-10-24-22-14-19-11-20(15-22)13-21(12-19)16-22/h17-21,23-24H,4-16H2,1-3H3.
What are the key properties of N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine?
N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine has a molecular weight of 334.59 g/mol, XLogP of 4.99, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-adamantyl)-N-(3,7-dimethyloctyl)ethane-1,2-diamine is sourced from PubChem (CID 46203484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).