C12H24N2 — CID 46203485
N'-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine (PubChem CID 46203485) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N'-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine.
| Compound Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 46203485 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCN |
| InChI | InChI=1S/C12H24N2/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7,14H,4,6,8-10,13H2,1-3H3/b12-7+ |
| InChIKey | JCIITWXLJRJGNM-KPKJPENVSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|