About 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione
2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione (PubChem CID 4620361) has the molecular formula C19H20O4
and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione |
| PubChem CID | 4620361 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1C(c1ccccc1)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C19H20O4/c20-13-8-4-9-14(21)18(13)17(12-6-2-1-3-7-12)19-15(22)10-5-11-16(19)23/h1-3,6-7,17-19H,4-5,8-11H2 |
| InChIKey | ALBGPVUTOJODLZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione?
The IUPAC name of 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione (CID 4620361) is 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione.
What is the SMILES notation for 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione?
The canonical SMILES for 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione is O=C1CCCC(=O)C1C(c1ccccc1)C1C(=O)CCCC1=O.
What is the InChIKey of 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione?
The InChIKey is ALBGPVUTOJODLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4/c20-13-8-4-9-14(21)18(13)17(12-6-2-1-3-7-12)19-15(22)10-5-11-16(19)23/h1-3,6-7,17-19H,4-5,8-11H2.
What are the key properties of 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione?
2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione has a molecular weight of 312.36 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dioxocyclohexyl)-phenylmethyl]cyclohexane-1,3-dione is sourced from PubChem (CID 4620361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).