About Pf-05212377
Pf-05212377 (PubChem CID 46203710) has the molecular formula C18H20N4O2S
and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-methyl-4-piperazin-1-ylbenzimidazole.
Molecular Properties
| Compound Name | Pf-05212377 |
| PubChem CID | 46203710 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(benzenesulfonyl)-2-methyl-4-piperazin-1-ylbenzimidazole |
| SMILES | CC1=NC2=C(N1S(=O)(=O)C3=CC=CC=C3)C=CC=C2N4CCNCC4 |
| InChI | InChI=1S/C18H20N4O2S/c1-14-20-18-16(21-12-10-19-11-13-21)8-5-9-17(18)22(14)25(23,24)15-6-3-2-4-7-15/h2-9,19H,10-13H2,1H3 |
| InChIKey | MAYQIFVKVAUMPD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | 552 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Pf-05212377 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pf-05212377?
The IUPAC name of Pf-05212377 (CID 46203710) is 1-(benzenesulfonyl)-2-methyl-4-piperazin-1-ylbenzimidazole.
What is the SMILES notation for Pf-05212377?
The canonical SMILES for Pf-05212377 is CC1=NC2=C(N1S(=O)(=O)C3=CC=CC=C3)C=CC=C2N4CCNCC4.
What is the InChIKey of Pf-05212377?
The InChIKey is MAYQIFVKVAUMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2S/c1-14-20-18-16(21-12-10-19-11-13-21)8-5-9-17(18)22(14)25(23,24)15-6-3-2-4-7-15/h2-9,19H,10-13H2,1H3.
What are the key properties of Pf-05212377?
Pf-05212377 has a molecular weight of 356.40 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Pf-05212377 is sourced from PubChem (CID 46203710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).