About N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide
N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide (PubChem CID 4620378) has the molecular formula C15H20N2OS
and a molecular weight of 276.40 g/mol. Its IUPAC name is N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide |
| PubChem CID | 4620378 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide |
| SMILES | CC1C2CC(CC2=NNC(=O)c2cccs2)C1(C)C |
| InChI | InChI=1S/C15H20N2OS/c1-9-11-7-10(15(9,2)3)8-12(11)16-17-14(18)13-5-4-6-19-13/h4-6,9-11H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | YRQOWXOKZAQXES-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide?
The IUPAC name of N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide (CID 4620378) is N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide.
What is the SMILES notation for N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide?
The canonical SMILES for N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide is CC1C2CC(CC2=NNC(=O)c2cccs2)C1(C)C.
What is the InChIKey of N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide?
The InChIKey is YRQOWXOKZAQXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS/c1-9-11-7-10(15(9,2)3)8-12(11)16-17-14(18)13-5-4-6-19-13/h4-6,9-11H,7-8H2,1-3H3,(H,17,18).
What are the key properties of N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide?
N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide has a molecular weight of 276.40 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]thiophene-2-carboxamide is sourced from PubChem (CID 4620378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).