C49H49FO5S — CID 46203854
(2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane (PubChem CID 46203854) has the molecular formula C49H49FO5S and a molecular weight of 768.99 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane |
|---|---|
| PubChem CID | 46203854 |
| Molecular Formula | C49H49FO5S |
| Molecular Weight | 768.99 g/mol |
| Exact Mass | 768.33 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2F)cc1 |
| InChI | InChI=1S/C49H49FO5S/c1-2-52-43-26-23-36(24-27-43)29-42-30-41(25-28-44(42)50)49-48(55-34-40-21-13-6-14-22-40)47(54-33-39-19-11-5-12-20-39)46(53-32-38-17-9-4-10-18-38)45(56-49)35-51-31-37-15-7-3-8-16-37/h3-28,30,45-49H,2,29,31-35H2,1H3/t45-,46-,47+,48?,49+/m1/s1 |
| InChIKey | HNPODPBESNJTPT-DTLDIRDLSA-N |
| XLogP | 10.94 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.99 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |