About 1-benzyl-4-decyltriazole
1-benzyl-4-decyltriazole (PubChem CID 46204132) has the molecular formula C19H29N3
and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-benzyl-4-decyltriazole.
Molecular Properties
| Compound Name | 1-benzyl-4-decyltriazole |
| PubChem CID | 46204132 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-benzyl-4-decyltriazole |
| SMILES | CCCCCCCCCCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H29N3/c1-2-3-4-5-6-7-8-12-15-19-17-22(21-20-19)16-18-13-10-9-11-14-18/h9-11,13-14,17H,2-8,12,15-16H2,1H3 |
| InChIKey | QUQOYEQXTSAKAT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-decyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-decyltriazole?
The IUPAC name of 1-benzyl-4-decyltriazole (CID 46204132) is 1-benzyl-4-decyltriazole.
What is the SMILES notation for 1-benzyl-4-decyltriazole?
The canonical SMILES for 1-benzyl-4-decyltriazole is CCCCCCCCCCc1cn(Cc2ccccc2)nn1.
What is the InChIKey of 1-benzyl-4-decyltriazole?
The InChIKey is QUQOYEQXTSAKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3/c1-2-3-4-5-6-7-8-12-15-19-17-22(21-20-19)16-18-13-10-9-11-14-18/h9-11,13-14,17H,2-8,12,15-16H2,1H3.
What are the key properties of 1-benzyl-4-decyltriazole?
1-benzyl-4-decyltriazole has a molecular weight of 299.46 g/mol, XLogP of 5.01, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-decyltriazole is sourced from PubChem (CID 46204132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).