About 1,4-dicyclohexyltriazole
1,4-dicyclohexyltriazole (PubChem CID 46204135) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 1,4-dicyclohexyltriazole.
Molecular Properties
| Compound Name | 1,4-dicyclohexyltriazole |
| PubChem CID | 46204135 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1,4-dicyclohexyltriazole |
| SMILES | c1c(C2CCCCC2)nnn1C1CCCCC1 |
| InChI | InChI=1S/C14H23N3/c1-3-7-12(8-4-1)14-11-17(16-15-14)13-9-5-2-6-10-13/h11-13H,1-10H2 |
| InChIKey | XFWUEFKZSHNZKQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dicyclohexyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dicyclohexyltriazole?
The IUPAC name of 1,4-dicyclohexyltriazole (CID 46204135) is 1,4-dicyclohexyltriazole.
What is the SMILES notation for 1,4-dicyclohexyltriazole?
The canonical SMILES for 1,4-dicyclohexyltriazole is c1c(C2CCCCC2)nnn1C1CCCCC1.
What is the InChIKey of 1,4-dicyclohexyltriazole?
The InChIKey is XFWUEFKZSHNZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c1-3-7-12(8-4-1)14-11-17(16-15-14)13-9-5-2-6-10-13/h11-13H,1-10H2.
What are the key properties of 1,4-dicyclohexyltriazole?
1,4-dicyclohexyltriazole has a molecular weight of 233.36 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dicyclohexyltriazole is sourced from PubChem (CID 46204135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).