About dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate
dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate (PubChem CID 46204253) has the molecular formula C17H12K2N2O5
and a molecular weight of 402.49 g/mol. Its IUPAC name is dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate.
Molecular Properties
| Compound Name | dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate |
| PubChem CID | 46204253 |
| Molecular Formula | C17H12K2N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate |
| SMILES | O=C([O-])C(Oc1nn(Cc2ccccc2)c2ccccc12)C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C17H14N2O5.2K/c20-16(21)14(17(22)23)24-15-12-8-4-5-9-13(12)19(18-15)10-11-6-2-1-3-7-11;;/h1-9,14H,10H2,(H,20,21)(H,22,23);;/q;2*+1/p-2 |
| InChIKey | WMZPGMRODZEIIV-UHFFFAOYSA-L |
| XLogP | -6.66 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate?
The IUPAC name of dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate (CID 46204253) is dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate.
What is the SMILES notation for dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate?
The canonical SMILES for dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate is O=C([O-])C(Oc1nn(Cc2ccccc2)c2ccccc12)C(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate?
The InChIKey is WMZPGMRODZEIIV-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H14N2O5.2K/c20-16(21)14(17(22)23)24-15-12-8-4-5-9-13(12)19(18-15)10-11-6-2-1-3-7-11;;/h1-9,14H,10H2,(H,20,21)(H,22,23);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate?
dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate has a molecular weight of 402.49 g/mol, XLogP of -6.66, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-(1-benzylindazol-3-yl)oxypropanedioate is sourced from PubChem (CID 46204253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).