C25H31ClN2O — CID 46204318
(3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5-ethyl-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one (PubChem CID 46204318) has the molecular formula C25H31ClN2O and a molecular weight of 410.99 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5-ethyl-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5-ethyl-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one |
|---|---|
| PubChem CID | 46204318 |
| Molecular Formula | C25H31ClN2O |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5-ethyl-9a,11a-dimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one |
| SMILES | CCN1C[C@@H]2[C@H](CC[C@]3(C)C(c4cnccc4Cl)=CC[C@@H]23)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C25H31ClN2O/c1-4-28-15-18-20-6-5-19(17-14-27-12-9-22(17)26)24(20,2)11-8-21(18)25(3)10-7-16(29)13-23(25)28/h5,9,12-14,18,20-21H,4,6-8,10-11,15H2,1-3H3/t18-,20-,21-,24+,25+/m0/s1 |
| InChIKey | XFCYKWGMMBCESA-XPMKPVRUSA-N |
| XLogP | 5.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |