About (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide
(S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide (PubChem CID 46204795) has the molecular formula C13H25NO3S2
and a molecular weight of 307.48 g/mol. Its IUPAC name is (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 46204795 |
| Molecular Formula | C13H25NO3S2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)NC1([C@H]2CCS2(=O)=O)CCCCC1 |
| InChI | InChI=1S/C13H25NO3S2/c1-12(2,3)18(15)14-13(8-5-4-6-9-13)11-7-10-19(11,16)17/h11,14H,4-10H2,1-3H3/t11-,18+/m1/s1 |
| InChIKey | RGGQFLSXAJTKPT-ZMZPIMSZSA-N |
| XLogP | 1.93 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide (CID 46204795) is (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide is CC(C)(C)[S@](=O)NC1([C@H]2CCS2(=O)=O)CCCCC1.
What is the InChIKey of (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide?
The InChIKey is RGGQFLSXAJTKPT-ZMZPIMSZSA-N. The full InChI is InChI=1S/C13H25NO3S2/c1-12(2,3)18(15)14-13(8-5-4-6-9-13)11-7-10-19(11,16)17/h11,14H,4-10H2,1-3H3/t11-,18+/m1/s1.
What are the key properties of (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide?
(S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide has a molecular weight of 307.48 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-[1-[(2R)-1,1-dioxothietan-2-yl]cyclohexyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 46204795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).