About [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate
[4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate (PubChem CID 46204804) has the molecular formula C27H36BrFNO5P
and a molecular weight of 584.46 g/mol. Its IUPAC name is [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate.
Molecular Properties
| Compound Name | [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate |
| PubChem CID | 46204804 |
| Molecular Formula | C27H36BrFNO5P |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate |
| SMILES | CC1=NC(CCc2ccc(-c3ccc(Br)cc3F)cc2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C27H36BrFNO5P/c1-19-30-27(17-32-19,18-33-36(31,34-25(2,3)4)35-26(5,6)7)15-14-20-8-10-21(11-9-20)23-13-12-22(28)16-24(23)29/h8-13,16H,14-15,17-18H2,1-7H3 |
| InChIKey | RONTUNOEPKXNNX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
The IUPAC name of [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate (CID 46204804) is [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate.
What is the SMILES notation for [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
The canonical SMILES for [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate is CC1=NC(CCc2ccc(-c3ccc(Br)cc3F)cc2)(COP(=O)(OC(C)(C)C)OC(C)(C)C)CO1.
What is the InChIKey of [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
The InChIKey is RONTUNOEPKXNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36BrFNO5P/c1-19-30-27(17-32-19,18-33-36(31,34-25(2,3)4)35-26(5,6)7)15-14-20-8-10-21(11-9-20)23-13-12-22(28)16-24(23)29/h8-13,16H,14-15,17-18H2,1-7H3.
What are the key properties of [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate?
[4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate has a molecular weight of 584.46 g/mol, XLogP of 8.13, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(4-bromo-2-fluorophenyl)phenyl]ethyl]-2-methyl-5H-1,3-oxazol-4-yl]methyl ditert-butyl phosphate is sourced from PubChem (CID 46204804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).