C21H25FO5S — CID 46204818
(2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 46204818) has the molecular formula C21H25FO5S and a molecular weight of 408.49 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 46204818 |
| Molecular Formula | C21H25FO5S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2F)cc1 |
| InChI | InChI=1S/C21H25FO5S/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | WHTOKCOXLADFOJ-ADAARDCZSA-N |
| XLogP | 2.05 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |