C22H28O5S — CID 46204819
(2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 46204819) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 46204819 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C22H28O5S/c1-3-27-17-8-5-14(6-9-17)10-16-11-15(7-4-13(16)2)22-21(26)20(25)19(24)18(12-23)28-22/h4-9,11,18-26H,3,10,12H2,1-2H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | VHPWZRKILUBNOT-BDHVOXNPSA-N |
| XLogP | 2.22 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |