C23H30O7S — CID 46204822
(2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 46204822) has the molecular formula C23H30O7S and a molecular weight of 450.55 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 46204822 |
| Molecular Formula | C23H30O7S |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C23H30O7S/c1-4-30-15-7-5-13(6-8-15)9-14-10-16(18(29-3)11-17(14)28-2)23-22(27)21(26)20(25)19(12-24)31-23/h5-8,10-11,19-27H,4,9,12H2,1-3H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | ZRLDSLVOXWXKGN-ZQGJOIPISA-N |
| XLogP | 1.92 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |