C35H23N7O3 — CID 46205388
11-anilino-N-(9,10-dioxoanthracen-2-yl)-5-methyl-3-phenyl-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-10-carboxamide (PubChem CID 46205388) has the molecular formula C35H23N7O3 and a molecular weight of 589.62 g/mol. Its IUPAC name is 11-anilino-N-(9,10-dioxoanthracen-2-yl)-5-methyl-3-phenyl-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-10-carboxamide.
| Compound Name | 11-anilino-N-(9,10-dioxoanthracen-2-yl)-5-methyl-3-phenyl-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-10-carboxamide |
|---|---|
| PubChem CID | 46205388 |
| Molecular Formula | C35H23N7O3 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 11-anilino-N-(9,10-dioxoanthracen-2-yl)-5-methyl-3-phenyl-1,3,4,8,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-10-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1cnc1c(C(=O)Nc3ccc4c(c3)C(=O)c3ccccc3C4=O)c(Nc3ccccc3)nn12 |
| InChI | InChI=1S/C35H23N7O3/c1-20-28-19-36-33-29(34(45)38-22-16-17-26-27(18-22)31(44)25-15-9-8-14-24(25)30(26)43)32(37-21-10-4-2-5-11-21)40-42(33)35(28)41(39-20)23-12-6-3-7-13-23/h2-19H,1H3,(H,37,40)(H,38,45) |
| InChIKey | MHCXMCQOEGVFTG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|