C14H13N7O — CID 46205483
4-(4-methoxyphenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 46205483) has the molecular formula C14H13N7O and a molecular weight of 295.31 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | 4-(4-methoxyphenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 46205483 |
| Molecular Formula | C14H13N7O |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | COc1ccc(-c2nc3c4cn(C)nc4nc(N)n3n2)cc1 |
| InChI | InChI=1S/C14H13N7O/c1-20-7-10-12(18-20)17-14(15)21-13(10)16-11(19-21)8-3-5-9(22-2)6-4-8/h3-7H,1-2H3,(H2,15,17,18) |
| InChIKey | CZTHOMSSFZEDSJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |