C13H10N8O2 — CID 46205484
11-methyl-4-(4-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 46205484) has the molecular formula C13H10N8O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 11-methyl-4-(4-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | 11-methyl-4-(4-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 46205484 |
| Molecular Formula | C13H10N8O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 11-methyl-4-(4-nitrophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | Cn1cc2c(nc(N)n3nc(-c4ccc([N+](=O)[O-])cc4)nc23)n1 |
| InChI | InChI=1S/C13H10N8O2/c1-19-6-9-11(17-19)16-13(14)20-12(9)15-10(18-20)7-2-4-8(5-3-7)21(22)23/h2-6H,1H3,(H2,14,16,17) |
| InChIKey | SAAANUYWBMKBFR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|