C15H10N4OS — CID 46205578
12-amino-10-thiophen-2-yl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-11-carbonitrile (PubChem CID 46205578) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 12-amino-10-thiophen-2-yl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-11-carbonitrile.
| Compound Name | 12-amino-10-thiophen-2-yl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-11-carbonitrile |
|---|---|
| PubChem CID | 46205578 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 12-amino-10-thiophen-2-yl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-11-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(ccn3ccnc23)C1c1cccs1 |
| InChI | InChI=1S/C15H10N4OS/c16-8-10-12(11-2-1-7-21-11)9-3-5-19-6-4-18-15(19)13(9)20-14(10)17/h1-7,12H,17H2 |
| InChIKey | LSOMQDQQDGZKFL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |