C34H23N5O4 — CID 46205714
2-anilino-N-(9,10-dioxoanthracen-2-yl)-7-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 46205714) has the molecular formula C34H23N5O4 and a molecular weight of 565.59 g/mol. Its IUPAC name is 2-anilino-N-(9,10-dioxoanthracen-2-yl)-7-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-anilino-N-(9,10-dioxoanthracen-2-yl)-7-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 46205714 |
| Molecular Formula | C34H23N5O4 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-anilino-N-(9,10-dioxoanthracen-2-yl)-7-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc(-c2ccnc3c(C(=O)Nc4ccc5c(c4)C(=O)c4ccccc4C5=O)c(Nc4ccccc4)nn23)cc1 |
| InChI | InChI=1S/C34H23N5O4/c1-43-23-14-11-20(12-15-23)28-17-18-35-33-29(32(38-39(28)33)36-21-7-3-2-4-8-21)34(42)37-22-13-16-26-27(19-22)31(41)25-10-6-5-9-24(25)30(26)40/h2-19H,1H3,(H,36,38)(H,37,42) |
| InChIKey | YZDPDTAPQVZZPQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|