About 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine
3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine (PubChem CID 46206344) has the molecular formula C18H20ClN
and a molecular weight of 285.82 g/mol. Its IUPAC name is 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine.
Molecular Properties
| Compound Name | 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine |
| PubChem CID | 46206344 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2C2CCNC2)cc1C |
| InChI | InChI=1S/C18H20ClN/c1-12-3-4-14(9-13(12)2)17-6-5-16(19)10-18(17)15-7-8-20-11-15/h3-6,9-10,15,20H,7-8,11H2,1-2H3 |
| InChIKey | KKZGJYKQPRGNLC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine?
The IUPAC name of 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine (CID 46206344) is 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine.
What is the SMILES notation for 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine?
The canonical SMILES for 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine is Cc1ccc(-c2ccc(Cl)cc2C2CCNC2)cc1C.
What is the InChIKey of 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine?
The InChIKey is KKZGJYKQPRGNLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN/c1-12-3-4-14(9-13(12)2)17-6-5-16(19)10-18(17)15-7-8-20-11-15/h3-6,9-10,15,20H,7-8,11H2,1-2H3.
What are the key properties of 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine?
3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine has a molecular weight of 285.82 g/mol, XLogP of 4.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-chloro-2-(3,4-dimethylphenyl)phenyl]pyrrolidine is sourced from PubChem (CID 46206344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).