C27H38O17S — CID 46206405
[(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-methoxy-5-[(3S,4S,5R,6R)-2,3,5-triacetyloxy-6-(acetyloxymethyl)oxan-4-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 46206405) has the molecular formula C27H38O17S and a molecular weight of 666.65 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-methoxy-5-[(3S,4S,5R,6R)-2,3,5-triacetyloxy-6-(acetyloxymethyl)oxan-4-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-methoxy-5-[(3S,4S,5R,6R)-2,3,5-triacetyloxy-6-(acetyloxymethyl)oxan-4-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46206405 |
| Molecular Formula | C27H38O17S |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4-diacetyloxy-6-methoxy-5-[(3S,4S,5R,6R)-2,3,5-triacetyloxy-6-(acetyloxymethyl)oxan-4-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1S[C@H]1[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H38O17S/c1-11(28)36-9-18-20(38-13(3)30)22(40-15(5)32)25(27(35-8)44-18)45-24-21(39-14(4)31)19(10-37-12(2)29)43-26(42-17(7)34)23(24)41-16(6)33/h18-27H,9-10H2,1-8H3/t18-,19-,20-,21-,22+,23-,24+,25+,26?,27+/m1/s1 |
| InChIKey | KWRWOKXWIFLMAA-IHHINWDMSA-N |
| XLogP | -0.03 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|