C15H17N3O3 — CID 46206422
(3S)-2-[(2S)-2-aminopropanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 46206422) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-aminopropanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (3S)-2-[(2S)-2-aminopropanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 46206422 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3S)-2-[(2S)-2-aminopropanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | C[C@H](N)C(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)O |
| InChI | InChI=1S/C15H17N3O3/c1-8(16)14(19)18-7-12-10(6-13(18)15(20)21)9-4-2-3-5-11(9)17-12/h2-5,8,13,17H,6-7,16H2,1H3,(H,20,21)/t8-,13-/m0/s1 |
| InChIKey | CFWYAEUBLLTSIB-SDBXPKJASA-N |
| XLogP | 0.85 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|