C17H21N3O3 — CID 46206424
(3S)-2-[(2S)-2-amino-3-methylbutanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 46206424) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-amino-3-methylbutanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (3S)-2-[(2S)-2-amino-3-methylbutanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 46206424 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (3S)-2-[(2S)-2-amino-3-methylbutanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H21N3O3/c1-9(2)15(18)16(21)20-8-13-11(7-14(20)17(22)23)10-5-3-4-6-12(10)19-13/h3-6,9,14-15,19H,7-8,18H2,1-2H3,(H,22,23)/t14-,15-/m0/s1 |
| InChIKey | GMKDWVDJKZNUSY-GJZGRUSLSA-N |
| XLogP | 1.49 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|