C27H18ClN7O2 — CID 46206464
N-benzoyl-N-[4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]benzamide (PubChem CID 46206464) has the molecular formula C27H18ClN7O2 and a molecular weight of 507.94 g/mol. Its IUPAC name is N-benzoyl-N-[4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]benzamide.
| Compound Name | N-benzoyl-N-[4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]benzamide |
|---|---|
| PubChem CID | 46206464 |
| Molecular Formula | C27H18ClN7O2 |
| Molecular Weight | 507.94 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-benzoyl-N-[4-(4-chlorophenyl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]benzamide |
| SMILES | Cn1cc2c(nc(N(C(=O)c3ccccc3)C(=O)c3ccccc3)n3nc(-c4ccc(Cl)cc4)nc23)n1 |
| InChI | InChI=1S/C27H18ClN7O2/c1-33-16-21-23(31-33)30-27(35-24(21)29-22(32-35)17-12-14-20(28)15-13-17)34(25(36)18-8-4-2-5-9-18)26(37)19-10-6-3-7-11-19/h2-16H,1H3 |
| InChIKey | JOZDSZQTJWNAIG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.94 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|