C36H40N4O5S — CID 46206496
3-N-[(1R,2S)-1-hydroxy-3-phenyl-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-5-[methyl(methylsulfonyl)amino]-1-N-[(1S)-1-phenylethyl]benzene-1,3-dicarboxamide (PubChem CID 46206496) has the molecular formula C36H40N4O5S and a molecular weight of 640.81 g/mol. Its IUPAC name is 3-N-[(1R,2S)-1-hydroxy-3-phenyl-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-5-[methyl(methylsulfonyl)amino]-1-N-[(1S)-1-phenylethyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[(1R,2S)-1-hydroxy-3-phenyl-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-5-[methyl(methylsulfonyl)amino]-1-N-[(1S)-1-phenylethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46206496 |
| Molecular Formula | C36H40N4O5S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | 3-N-[(1R,2S)-1-hydroxy-3-phenyl-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-5-[methyl(methylsulfonyl)amino]-1-N-[(1S)-1-phenylethyl]benzene-1,3-dicarboxamide |
| SMILES | C[C@H](NC(=O)c1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)C2Cc3ccccc3CN2)cc(N(C)S(C)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C36H40N4O5S/c1-24(26-14-8-5-9-15-26)38-35(42)29-19-30(21-31(20-29)40(2)46(3,44)45)36(43)39-33(18-25-12-6-4-7-13-25)34(41)32-22-27-16-10-11-17-28(27)23-37-32/h4-17,19-21,24,32-34,37,41H,18,22-23H2,1-3H3,(H,38,42)(H,39,43)/t24-,32?,33-,34+/m0/s1 |
| InChIKey | FIXSTMUJFGKBBA-MSSLVDEGSA-N |
| XLogP | 3.99 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |