C26H38O16S — CID 46206756
[(2R,3R,4R,5S,6R)-3,5-diacetyloxy-4-[(2R,3R,4R,5S,6R)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-methoxyoxan-4-yl]sulfanyl-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 46206756) has the molecular formula C26H38O16S and a molecular weight of 638.64 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,5-diacetyloxy-4-[(2R,3R,4R,5S,6R)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-methoxyoxan-4-yl]sulfanyl-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,5-diacetyloxy-4-[(2R,3R,4R,5S,6R)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-methoxyoxan-4-yl]sulfanyl-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46206756 |
| Molecular Formula | C26H38O16S |
| Molecular Weight | 638.64 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,5-diacetyloxy-4-[(2R,3R,4R,5S,6R)-3,5-diacetyloxy-2-(acetyloxymethyl)-6-methoxyoxan-4-yl]sulfanyl-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](S[C@H]2[C@@H](OC(C)=O)[C@H](OC)O[C@H](COC(C)=O)[C@H]2OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O16S/c1-11(27)35-9-17-19(37-13(3)29)23(21(39-15(5)31)25(33-7)41-17)43-24-20(38-14(4)30)18(10-36-12(2)28)42-26(34-8)22(24)40-16(6)32/h17-26H,9-10H2,1-8H3/t17-,18-,19-,20-,21-,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | MMLPAEPKSVQRCK-VCVUPCPRSA-N |
| XLogP | 0.05 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.64 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|