C26H29N7O4 — CID 46206784
1-[4-[7-(2,2-dimethoxyethyl)-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl]phenyl]-3-pyridin-4-ylurea (PubChem CID 46206784) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is 1-[4-[7-(2,2-dimethoxyethyl)-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl]phenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[4-[7-(2,2-dimethoxyethyl)-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl]phenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 46206784 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 1-[4-[7-(2,2-dimethoxyethyl)-4-morpholin-4-ylpyrrolo[2,3-d]pyrimidin-2-yl]phenyl]-3-pyridin-4-ylurea |
| SMILES | COC(Cn1ccc2c(N3CCOCC3)nc(-c3ccc(NC(=O)Nc4ccncc4)cc3)nc21)OC |
| InChI | InChI=1S/C26H29N7O4/c1-35-22(36-2)17-33-12-9-21-24(32-13-15-37-16-14-32)30-23(31-25(21)33)18-3-5-19(6-4-18)28-26(34)29-20-7-10-27-11-8-20/h3-12,22H,13-17H2,1-2H3,(H2,27,28,29,34) |
| InChIKey | WTSKLBVBUJRZSO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|