About 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline
2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 46206870) has the molecular formula C17H10N4S
and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline |
| PubChem CID | 46206870 |
| Molecular Formula | C17H10N4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1csc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1 |
| InChI | InChI=1S/C17H10N4S/c1-4-10-13(18-7-1)14-11(5-2-8-19-14)16-15(10)20-17(21-16)12-6-3-9-22-12/h1-9H,(H,20,21) |
| InChIKey | MMKDCKFENYAPKS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline?
The IUPAC name of 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline (CID 46206870) is 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline.
What is the SMILES notation for 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline?
The canonical SMILES for 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline is c1csc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1.
What is the InChIKey of 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline?
The InChIKey is MMKDCKFENYAPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N4S/c1-4-10-13(18-7-1)14-11(5-2-8-19-14)16-15(10)20-17(21-16)12-6-3-9-22-12/h1-9H,(H,20,21).
What are the key properties of 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline?
2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline has a molecular weight of 302.36 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-yl-1H-imidazo[4,5-f][1,10]phenanthroline is sourced from PubChem (CID 46206870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).