C27H28ClN5O3 — CID 46206879
3-chloro-N-[[(4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]methyl]benzamide (PubChem CID 46206879) has the molecular formula C27H28ClN5O3 and a molecular weight of 506.01 g/mol. Its IUPAC name is 3-chloro-N-[[(4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]methyl]benzamide.
| Compound Name | 3-chloro-N-[[(4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 46206879 |
| Molecular Formula | C27H28ClN5O3 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 3-chloro-N-[[(4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]methyl]benzamide |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC[C@@H]3CNC(=O)c2cccc(Cl)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H28ClN5O3/c1-18-15-32(17-30-18)24-9-8-19(12-25(24)35-2)11-20-6-4-10-33-23(16-36-31-26(20)33)14-29-27(34)21-5-3-7-22(28)13-21/h3,5,7-9,11-13,15,17,23H,4,6,10,14,16H2,1-2H3,(H,29,34)/b20-11+/t23-/m0/s1 |
| InChIKey | IRTNKWBTUHFICV-ZVANETARSA-N |
| XLogP | 4.46 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |