About (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid
(1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid (PubChem CID 46206903) has the molecular formula C5H6Cl2N2O5S
and a molecular weight of 277.09 g/mol. Its IUPAC name is (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid.
Molecular Properties
| Compound Name | (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid |
| PubChem CID | 46206903 |
| Molecular Formula | C5H6Cl2N2O5S |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 275.94 |
| IUPAC Name | (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid |
| SMILES | CC1(CS(=O)(=O)O)C(=O)N(Cl)C(=O)N1Cl |
| InChI | InChI=1S/C5H6Cl2N2O5S/c1-5(2-15(12,13)14)3(10)8(6)4(11)9(5)7/h2H2,1H3,(H,12,13,14) |
| InChIKey | NEBQOGRQUVLBHK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid?
The IUPAC name of (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid (CID 46206903) is (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid.
What is the SMILES notation for (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid?
The canonical SMILES for (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid is CC1(CS(=O)(=O)O)C(=O)N(Cl)C(=O)N1Cl.
What is the InChIKey of (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid?
The InChIKey is NEBQOGRQUVLBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2N2O5S/c1-5(2-15(12,13)14)3(10)8(6)4(11)9(5)7/h2H2,1H3,(H,12,13,14).
What are the key properties of (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid?
(1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid has a molecular weight of 277.09 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dichloro-4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonic acid is sourced from PubChem (CID 46206903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).