C21H21N3O — CID 46207139
(3S)-3-amino-4-(1H-imidazol-5-yl)-1-[4-[(E)-2-phenylethenyl]phenyl]butan-2-one (PubChem CID 46207139) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (3S)-3-amino-4-(1H-imidazol-5-yl)-1-[4-[(E)-2-phenylethenyl]phenyl]butan-2-one.
| Compound Name | (3S)-3-amino-4-(1H-imidazol-5-yl)-1-[4-[(E)-2-phenylethenyl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 46207139 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (3S)-3-amino-4-(1H-imidazol-5-yl)-1-[4-[(E)-2-phenylethenyl]phenyl]butan-2-one |
| SMILES | N[C@@H](Cc1cnc[nH]1)C(=O)Cc1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N3O/c22-20(13-19-14-23-15-24-19)21(25)12-18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h1-11,14-15,20H,12-13,22H2,(H,23,24)/b7-6+/t20-/m0/s1 |
| InChIKey | OXUCIUZQKBTFOK-YJJPMGAVSA-N |
| XLogP | 3.26 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|