C16H21N5O — CID 46207314
(E)-1-[6-[(E)-3,3-dimethylbut-1-enyl]-2-pyridinyl]-N-ethoxy-1-(1,2,4-triazol-1-yl)methanimine (PubChem CID 46207314) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is (E)-1-[6-[(E)-3,3-dimethylbut-1-enyl]-2-pyridinyl]-N-ethoxy-1-(1,2,4-triazol-1-yl)methanimine.
| Compound Name | (E)-1-[6-[(E)-3,3-dimethylbut-1-enyl]-2-pyridinyl]-N-ethoxy-1-(1,2,4-triazol-1-yl)methanimine |
|---|---|
| PubChem CID | 46207314 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (E)-1-[6-[(E)-3,3-dimethylbut-1-enyl]-2-pyridinyl]-N-ethoxy-1-(1,2,4-triazol-1-yl)methanimine |
| SMILES | CCO/N=C(\c1cccc(/C=C/C(C)(C)C)n1)n1cncn1 |
| InChI | InChI=1S/C16H21N5O/c1-5-22-20-15(21-12-17-11-18-21)14-8-6-7-13(19-14)9-10-16(2,3)4/h6-12H,5H2,1-4H3/b10-9+,20-15+ |
| InChIKey | ZWGSAVGJNPMFFT-IJUUUJHDSA-N |
| XLogP | 2.98 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|