C22H18F4N4O — CID 46207385
5-[3-(3-fluoropropoxy)phenyl]-5-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[3,4-b]pyridin-7-amine (PubChem CID 46207385) has the molecular formula C22H18F4N4O and a molecular weight of 430.41 g/mol. Its IUPAC name is 5-[3-(3-fluoropropoxy)phenyl]-5-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[3,4-b]pyridin-7-amine.
| Compound Name | 5-[3-(3-fluoropropoxy)phenyl]-5-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[3,4-b]pyridin-7-amine |
|---|---|
| PubChem CID | 46207385 |
| Molecular Formula | C22H18F4N4O |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 5-[3-(3-fluoropropoxy)phenyl]-5-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[3,4-b]pyridin-7-amine |
| SMILES | NC1=NC(c2cccc(OCCCF)c2)(c2ccnc(C(F)(F)F)c2)c2cccnc21 |
| InChI | InChI=1S/C22H18F4N4O/c23-8-3-11-31-16-5-1-4-14(12-16)21(15-7-10-28-18(13-15)22(24,25)26)17-6-2-9-29-19(17)20(27)30-21/h1-2,4-7,9-10,12-13H,3,8,11H2,(H2,27,30) |
| InChIKey | KHXPQZSJSXZGKH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|