C19H28O6 — CID 46207398
(4R,5R,6R,7R,10R)-4,6,7-trihydroxy-10-[(E,3R,5S,6R)-6-hydroxy-3,5-dimethylhept-1-enyl]-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one (PubChem CID 46207398) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4R,5R,6R,7R,10R)-4,6,7-trihydroxy-10-[(E,3R,5S,6R)-6-hydroxy-3,5-dimethylhept-1-enyl]-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one.
| Compound Name | (4R,5R,6R,7R,10R)-4,6,7-trihydroxy-10-[(E,3R,5S,6R)-6-hydroxy-3,5-dimethylhept-1-enyl]-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 46207398 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (4R,5R,6R,7R,10R)-4,6,7-trihydroxy-10-[(E,3R,5S,6R)-6-hydroxy-3,5-dimethylhept-1-enyl]-3-methylidene-2-oxaspiro[4.5]dec-8-en-1-one |
| SMILES | C=C1OC(=O)[C@@]2([C@H](/C=C/[C@H](C)C[C@H](C)[C@@H](C)O)C=C[C@@H](O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C19H28O6/c1-10(9-11(2)12(3)20)5-6-14-7-8-15(21)17(23)19(14)16(22)13(4)25-18(19)24/h5-8,10-12,14-17,20-23H,4,9H2,1-3H3/b6-5+/t10-,11-,12+,14+,15+,16-,17-,19-/m0/s1 |
| InChIKey | SMJOYDRWSIYUPI-FZCVXSTPSA-N |
| XLogP | 0.91 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|