C40H45N3O11 — CID 46207666
2-[4-[4-[2,6-dimethoxy-3-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 46207666) has the molecular formula C40H45N3O11 and a molecular weight of 743.81 g/mol. Its IUPAC name is 2-[4-[4-[2,6-dimethoxy-3-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[4-[2,6-dimethoxy-3-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 46207666 |
| Molecular Formula | C40H45N3O11 |
| Molecular Weight | 743.81 g/mol |
| Exact Mass | 743.31 |
| IUPAC Name | 2-[4-[4-[2,6-dimethoxy-3-[5-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]phenoxy]butoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCCCOc3c(OC)ccc(C4=NOC(c5cc(OC)c(OC)c(OC)c5)C4)c3OC)c(OC)c1)N2 |
| InChI | InChI=1S/C40H45N3O11/c1-45-25-11-13-28-27(21-25)40(44)42-39(41-28)23-10-14-30(33(18-23)47-3)52-16-8-9-17-53-38-31(46-2)15-12-26(36(38)50-6)29-22-32(54-43-29)24-19-34(48-4)37(51-7)35(20-24)49-5/h10-15,18-21,32,39,41H,8-9,16-17,22H2,1-7H3,(H,42,44) |
| InChIKey | COJYYWDZGKNCNV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.81 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|