About 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium
1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium (PubChem CID 46207758) has the molecular formula C15H21F2NO2
and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium.
Molecular Properties
| Compound Name | 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium |
| PubChem CID | 46207758 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium |
| SMILES | CCCC[N+]1([O-])CCC(OC)(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H21F2NO2/c1-3-4-8-18(19)9-7-15(11-18,20-2)12-5-6-13(16)14(17)10-12/h5-6,10H,3-4,7-9,11H2,1-2H3 |
| InChIKey | ZYTBRNCLZGRSAE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium?
The IUPAC name of 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium (CID 46207758) is 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium.
What is the SMILES notation for 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium?
The canonical SMILES for 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium is CCCC[N+]1([O-])CCC(OC)(c2ccc(F)c(F)c2)C1.
What is the InChIKey of 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium?
The InChIKey is ZYTBRNCLZGRSAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO2/c1-3-4-8-18(19)9-7-15(11-18,20-2)12-5-6-13(16)14(17)10-12/h5-6,10H,3-4,7-9,11H2,1-2H3.
What are the key properties of 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium?
1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium has a molecular weight of 285.33 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-(3,4-difluorophenyl)-3-methoxy-1-oxidopyrrolidin-1-ium is sourced from PubChem (CID 46207758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).