About 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol
3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol (PubChem CID 46207883) has the molecular formula C12H15F2NO
and a molecular weight of 227.25 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol.
Molecular Properties
| Compound Name | 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol |
| PubChem CID | 46207883 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol |
| SMILES | CC(C)N1CC(O)(c2cccc(F)c2F)C1 |
| InChI | InChI=1S/C12H15F2NO/c1-8(2)15-6-12(16,7-15)9-4-3-5-10(13)11(9)14/h3-5,8,16H,6-7H2,1-2H3 |
| InChIKey | QAMCTGCQORPLOF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol?
The IUPAC name of 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol (CID 46207883) is 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol.
What is the SMILES notation for 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol?
The canonical SMILES for 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol is CC(C)N1CC(O)(c2cccc(F)c2F)C1.
What is the InChIKey of 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol?
The InChIKey is QAMCTGCQORPLOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO/c1-8(2)15-6-12(16,7-15)9-4-3-5-10(13)11(9)14/h3-5,8,16H,6-7H2,1-2H3.
What are the key properties of 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol?
3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol has a molecular weight of 227.25 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenyl)-1-propan-2-ylazetidin-3-ol is sourced from PubChem (CID 46207883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).