C40H48O11 — CID 46208134
(1R)-1-(3,4-dimethoxyphenyl)-2-[4-[(2S,3R,4R,5S)-5-[4-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxyethoxy]-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxyphenoxy]ethanol (PubChem CID 46208134) has the molecular formula C40H48O11 and a molecular weight of 704.81 g/mol. Its IUPAC name is (1R)-1-(3,4-dimethoxyphenyl)-2-[4-[(2S,3R,4R,5S)-5-[4-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxyethoxy]-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxyphenoxy]ethanol.
| Compound Name | (1R)-1-(3,4-dimethoxyphenyl)-2-[4-[(2S,3R,4R,5S)-5-[4-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxyethoxy]-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxyphenoxy]ethanol |
|---|---|
| PubChem CID | 46208134 |
| Molecular Formula | C40H48O11 |
| Molecular Weight | 704.81 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | (1R)-1-(3,4-dimethoxyphenyl)-2-[4-[(2S,3R,4R,5S)-5-[4-[(2R)-2-(3,4-dimethoxyphenyl)-2-hydroxyethoxy]-3-methoxyphenyl]-3,4-dimethyloxolan-2-yl]-2-methoxyphenoxy]ethanol |
| SMILES | COc1ccc([C@@H](O)COc2ccc([C@H]3O[C@H](c4ccc(OC[C@H](O)c5ccc(OC)c(OC)c5)c(OC)c4)[C@H](C)[C@H]3C)cc2OC)cc1OC |
| InChI | InChI=1S/C40H48O11/c1-23-24(2)40(28-12-16-34(38(20-28)48-8)50-22-30(42)26-10-14-32(44-4)36(18-26)46-6)51-39(23)27-11-15-33(37(19-27)47-7)49-21-29(41)25-9-13-31(43-3)35(17-25)45-5/h9-20,23-24,29-30,39-42H,21-22H2,1-8H3/t23-,24-,29+,30+,39+,40+/m1/s1 |
| InChIKey | NKHJQIMZBYZZNI-QEDKRPGDSA-N |
| XLogP | 7.05 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.81 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |