C24H26N2O3 — CID 46208909
N-(4-tert-butylphenyl)-4-[5-[(1R)-1,2-dihydroxyethyl]-2-pyridinyl]benzamide (PubChem CID 46208909) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[5-[(1R)-1,2-dihydroxyethyl]-2-pyridinyl]benzamide.
| Compound Name | N-(4-tert-butylphenyl)-4-[5-[(1R)-1,2-dihydroxyethyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 46208909 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[5-[(1R)-1,2-dihydroxyethyl]-2-pyridinyl]benzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccc(-c3ccc([C@@H](O)CO)cn3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-24(2,3)19-9-11-20(12-10-19)26-23(29)17-6-4-16(5-7-17)21-13-8-18(14-25-21)22(28)15-27/h4-14,22,27-28H,15H2,1-3H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | WYJUZWGQTHTTHD-QFIPXVFZSA-N |
| XLogP | 4.32 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |