About [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol
[2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol (PubChem CID 46209303) has the molecular formula C20H23FN2O3
and a molecular weight of 358.41 g/mol. Its IUPAC name is [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol.
Molecular Properties
| Compound Name | [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol |
| PubChem CID | 46209303 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)ccc1N1CCN(CC2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C20H23FN2O3/c21-16-5-6-18(15(11-16)13-24)23-9-7-22(8-10-23)12-17-14-25-19-3-1-2-4-20(19)26-17/h1-6,11,17,24H,7-10,12-14H2 |
| InChIKey | NACVGYQYJYIOOL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol?
The IUPAC name of [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol (CID 46209303) is [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol.
What is the SMILES notation for [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol?
The canonical SMILES for [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol is OCc1cc(F)ccc1N1CCN(CC2COc3ccccc3O2)CC1.
What is the InChIKey of [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol?
The InChIKey is NACVGYQYJYIOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O3/c21-16-5-6-18(15(11-16)13-24)23-9-7-22(8-10-23)12-17-14-25-19-3-1-2-4-20(19)26-17/h1-6,11,17,24H,7-10,12-14H2.
What are the key properties of [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol?
[2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol has a molecular weight of 358.41 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperazin-1-yl]-5-fluorophenyl]methanol is sourced from PubChem (CID 46209303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).