C22H16ClF3N6O — CID 46209557
4-amino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 46209557) has the molecular formula C22H16ClF3N6O and a molecular weight of 472.86 g/mol. Its IUPAC name is 4-amino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 46209557 |
| Molecular Formula | C22H16ClF3N6O |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 4-amino-2-[5-chloro-3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-n3nc(Cc4c(F)ccc(F)c4F)c4cc(Cl)ccc43)nc(N)c21 |
| InChI | InChI=1S/C22H16ClF3N6O/c1-22(2)16-18(27)28-21(30-19(16)29-20(22)33)32-15-6-3-9(23)7-11(15)14(31-32)8-10-12(24)4-5-13(25)17(10)26/h3-7H,8H2,1-2H3,(H3,27,28,29,30,33) |
| InChIKey | GTDUMDPQHXDMIF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|