About N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide
N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide (PubChem CID 46209585) has the molecular formula C16H24N4O2S2
and a molecular weight of 368.53 g/mol. Its IUPAC name is N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide |
| PubChem CID | 46209585 |
| Molecular Formula | C16H24N4O2S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C16H24N4O2S2/c1-13(2)24(21,22)19-11-6-3-5-10-18-16-20-15(12-23-16)14-8-4-7-9-17-14/h4,7-9,12-13,19H,3,5-6,10-11H2,1-2H3,(H,18,20) |
| InChIKey | OFIGBSCNGNSCPM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
The IUPAC name of N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide (CID 46209585) is N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide.
What is the SMILES notation for N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
The canonical SMILES for N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide is CC(C)S(=O)(=O)NCCCCCNc1nc(-c2ccccn2)cs1.
What is the InChIKey of N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
The InChIKey is OFIGBSCNGNSCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O2S2/c1-13(2)24(21,22)19-11-6-3-5-10-18-16-20-15(12-23-16)14-8-4-7-9-17-14/h4,7-9,12-13,19H,3,5-6,10-11H2,1-2H3,(H,18,20).
What are the key properties of N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide?
N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide has a molecular weight of 368.53 g/mol, XLogP of 3.12, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]propane-2-sulfonamide is sourced from PubChem (CID 46209585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).