C18H18O5 — CID 46209850
(1S,3S)-3-methyl-1-(1-oxo-3,4-dihydroisochromen-5-yl)-3,4,5,8-tetrahydro-1H-pyrano[3,4-c]pyran-6-one (PubChem CID 46209850) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (1S,3S)-3-methyl-1-(1-oxo-3,4-dihydroisochromen-5-yl)-3,4,5,8-tetrahydro-1H-pyrano[3,4-c]pyran-6-one.
| Compound Name | (1S,3S)-3-methyl-1-(1-oxo-3,4-dihydroisochromen-5-yl)-3,4,5,8-tetrahydro-1H-pyrano[3,4-c]pyran-6-one |
|---|---|
| PubChem CID | 46209850 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (1S,3S)-3-methyl-1-(1-oxo-3,4-dihydroisochromen-5-yl)-3,4,5,8-tetrahydro-1H-pyrano[3,4-c]pyran-6-one |
| SMILES | C[C@H]1CC2=C(COC(=O)C2)[C@H](c2cccc3c2CCOC3=O)O1 |
| InChI | InChI=1S/C18H18O5/c1-10-7-11-8-16(19)22-9-15(11)17(23-10)13-3-2-4-14-12(13)5-6-21-18(14)20/h2-4,10,17H,5-9H2,1H3/t10-,17-/m0/s1 |
| InChIKey | QOJREGNIFUJIKR-BTDLBPIBSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|