C16H28O3 — CID 46209992
(2R,4E,6S)-2-heptyl-6-hydroxy-2,3,6,7,8,9-hexahydrooxecin-10-one (PubChem CID 46209992) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2R,4E,6S)-2-heptyl-6-hydroxy-2,3,6,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,4E,6S)-2-heptyl-6-hydroxy-2,3,6,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 46209992 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2R,4E,6S)-2-heptyl-6-hydroxy-2,3,6,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCCC[C@@H]1C/C=C/[C@@H](O)CCCC(=O)O1 |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-5-6-11-15-12-7-9-14(17)10-8-13-16(18)19-15/h7,9,14-15,17H,2-6,8,10-13H2,1H3/b9-7+/t14-,15-/m1/s1 |
| InChIKey | HXPOEJHEWXNRQV-VIGJRRFGSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|