C19H33IO3Si — CID 46210181
methyl (4E,6S,8E,10E)-6-[tert-butyl(dimethyl)silyl]oxy-11-iodo-4-methylundeca-4,8,10-trienoate (PubChem CID 46210181) has the molecular formula C19H33IO3Si and a molecular weight of 464.46 g/mol. Its IUPAC name is methyl (4E,6S,8E,10E)-6-[tert-butyl(dimethyl)silyl]oxy-11-iodo-4-methylundeca-4,8,10-trienoate.
| Compound Name | methyl (4E,6S,8E,10E)-6-[tert-butyl(dimethyl)silyl]oxy-11-iodo-4-methylundeca-4,8,10-trienoate |
|---|---|
| PubChem CID | 46210181 |
| Molecular Formula | C19H33IO3Si |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | methyl (4E,6S,8E,10E)-6-[tert-butyl(dimethyl)silyl]oxy-11-iodo-4-methylundeca-4,8,10-trienoate |
| SMILES | COC(=O)CC/C(C)=C/[C@H](C/C=C/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33IO3Si/c1-16(12-13-18(21)22-5)15-17(11-9-8-10-14-20)23-24(6,7)19(2,3)4/h8-10,14-15,17H,11-13H2,1-7H3/b9-8+,14-10+,16-15+/t17-/m0/s1 |
| InChIKey | AENFEEMATYRDDD-KFJDUSMTSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|