C24H42O6 — CID 46210270
methyl (E,5S,9R)-9-acetyloxy-5-(oxan-2-yloxy)hexadec-6-enoate (PubChem CID 46210270) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is methyl (E,5S,9R)-9-acetyloxy-5-(oxan-2-yloxy)hexadec-6-enoate.
| Compound Name | methyl (E,5S,9R)-9-acetyloxy-5-(oxan-2-yloxy)hexadec-6-enoate |
|---|---|
| PubChem CID | 46210270 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | methyl (E,5S,9R)-9-acetyloxy-5-(oxan-2-yloxy)hexadec-6-enoate |
| SMILES | CCCCCCC[C@H](C/C=C/[C@H](CCCC(=O)OC)OC1CCCCO1)OC(C)=O |
| InChI | InChI=1S/C24H42O6/c1-4-5-6-7-8-13-21(29-20(2)25)14-11-15-22(16-12-17-23(26)27-3)30-24-18-9-10-19-28-24/h11,15,21-22,24H,4-10,12-14,16-19H2,1-3H3/b15-11+/t21-,22-,24?/m1/s1 |
| InChIKey | DYSFCENODBPQMA-KZMROCFRSA-N |
| XLogP | 5.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|