C19H16N6O2 — CID 46210399
2-azido-N-[(8S)-9-oxo-6,7,8,11-tetrahydropyrido[2,1-b]quinazolin-8-yl]benzamide (PubChem CID 46210399) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-azido-N-[(8S)-9-oxo-6,7,8,11-tetrahydropyrido[2,1-b]quinazolin-8-yl]benzamide.
| Compound Name | 2-azido-N-[(8S)-9-oxo-6,7,8,11-tetrahydropyrido[2,1-b]quinazolin-8-yl]benzamide |
|---|---|
| PubChem CID | 46210399 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-azido-N-[(8S)-9-oxo-6,7,8,11-tetrahydropyrido[2,1-b]quinazolin-8-yl]benzamide |
| SMILES | [N-]=[N+]=Nc1ccccc1C(=O)N[C@H]1CCC2=Nc3ccccc3CN2C1=O |
| InChI | InChI=1S/C19H16N6O2/c20-24-23-15-8-4-2-6-13(15)18(26)22-16-9-10-17-21-14-7-3-1-5-12(14)11-25(17)19(16)27/h1-8,16H,9-11H2,(H,22,26)/t16-/m0/s1 |
| InChIKey | VMLLXTRNFDSGRD-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|