C18H21ClO5 — CID 46210467
methyl (2E,3E,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylidene)-3-methylhexa-3,5-dienoate (PubChem CID 46210467) has the molecular formula C18H21ClO5 and a molecular weight of 352.81 g/mol. Its IUPAC name is methyl (2E,3E,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylidene)-3-methylhexa-3,5-dienoate.
| Compound Name | methyl (2E,3E,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylidene)-3-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 46210467 |
| Molecular Formula | C18H21ClO5 |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | methyl (2E,3E,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylidene)-3-methylhexa-3,5-dienoate |
| SMILES | CO/C=C(C(=O)OC)\C(C)=C(/C=C/c1ccc(Cl)c(OC)c1)OC |
| InChI | InChI=1S/C18H21ClO5/c1-12(14(11-21-2)18(20)24-5)16(22-3)9-7-13-6-8-15(19)17(10-13)23-4/h6-11H,1-5H3/b9-7+,14-11+,16-12+ |
| InChIKey | YMXFXCLZQAQAGG-WIMKLWOJSA-N |
| XLogP | 3.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|