C17H12N2O4 — CID 46210542
2'-benzylspiro[1,3-oxazolidine-5,3'-isoindole]-1',2,4-trione (PubChem CID 46210542) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2'-benzylspiro[1,3-oxazolidine-5,3'-isoindole]-1',2,4-trione.
| Compound Name | 2'-benzylspiro[1,3-oxazolidine-5,3'-isoindole]-1',2,4-trione |
|---|---|
| PubChem CID | 46210542 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2'-benzylspiro[1,3-oxazolidine-5,3'-isoindole]-1',2,4-trione |
| SMILES | O=C1NC(=O)C2(O1)c1ccccc1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H12N2O4/c20-14-12-8-4-5-9-13(12)17(15(21)18-16(22)23-17)19(14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,18,21,22) |
| InChIKey | LKUVODBTJJHLEY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |